C13H10N4OS — CID 770809
1-naphthalen-1-yl-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 770809) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-naphthalen-1-yl-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-naphthalen-1-yl-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 770809 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-naphthalen-1-yl-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1nncs1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C13H10N4OS/c18-12(16-13-17-14-8-19-13)15-11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,(H2,15,16,17,18) |
| InChIKey | HMNATDLXNSZYPH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |