C11H10N4O3S — CID 62948243
2-methyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid (PubChem CID 62948243) has the molecular formula C11H10N4O3S and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-methyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-methyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 62948243 |
| Molecular Formula | C11H10N4O3S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-methyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid |
| SMILES | Cc1c(NC(=O)Nc2nncs2)cccc1C(=O)O |
| InChI | InChI=1S/C11H10N4O3S/c1-6-7(9(16)17)3-2-4-8(6)13-10(18)14-11-15-12-5-19-11/h2-5H,1H3,(H,16,17)(H2,13,14,15,18) |
| InChIKey | HIAMFBLPJRPUDJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |