C10H7ClN4O3S — CID 61193058
4-chloro-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid (PubChem CID 61193058) has the molecular formula C10H7ClN4O3S and a molecular weight of 298.71 g/mol. Its IUPAC name is 4-chloro-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid.
| Compound Name | 4-chloro-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61193058 |
| Molecular Formula | C10H7ClN4O3S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 4-chloro-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1nncs1)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C10H7ClN4O3S/c11-6-2-1-5(8(16)17)3-7(6)13-9(18)14-10-15-12-4-19-10/h1-4H,(H,16,17)(H2,13,14,15,18) |
| InChIKey | FZFSBAGJMLXAQD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |