C14H10ClNO5 — CID 107702365
4-chloro-3-[(3,5-dihydroxybenzoyl)amino]benzoic acid (PubChem CID 107702365) has the molecular formula C14H10ClNO5 and a molecular weight of 307.69 g/mol. Its IUPAC name is 4-chloro-3-[(3,5-dihydroxybenzoyl)amino]benzoic acid.
| Compound Name | 4-chloro-3-[(3,5-dihydroxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107702365 |
| Molecular Formula | C14H10ClNO5 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4-chloro-3-[(3,5-dihydroxybenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(NC(=O)c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C14H10ClNO5/c15-11-2-1-7(14(20)21)5-12(11)16-13(19)8-3-9(17)6-10(18)4-8/h1-6,17-18H,(H,16,19)(H,20,21) |
| InChIKey | YFPSGCFJXFGEJQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |