C12H6Cl3NO3S — CID 107959571
4-chloro-3-[(2,5-dichlorothiophene-3-carbonyl)amino]benzoic acid (PubChem CID 107959571) has the molecular formula C12H6Cl3NO3S and a molecular weight of 350.61 g/mol. Its IUPAC name is 4-chloro-3-[(2,5-dichlorothiophene-3-carbonyl)amino]benzoic acid.
| Compound Name | 4-chloro-3-[(2,5-dichlorothiophene-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107959571 |
| Molecular Formula | C12H6Cl3NO3S |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | 4-chloro-3-[(2,5-dichlorothiophene-3-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(NC(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C12H6Cl3NO3S/c13-7-2-1-5(12(18)19)3-8(7)16-11(17)6-4-9(14)20-10(6)15/h1-4H,(H,16,17)(H,18,19) |
| InChIKey | FADBIYJEOZSGIC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |