4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid

C14H8Br2ClNO3 — CID 114367860

IUPAC4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(Cl)c(NC(=O)c2cc(Br)ccc2Br)c1
InChIInChI=1S/C14H8Br2ClNO3/c15-8-2-3-10(16)9(6-8)13(19)18-12-5-7(14(20)21)1-4-11(12)17/h1-6H,(H,18,19)(H,20,21)
InChIKeyURWJTRBMGFPQMB-UHFFFAOYSA-N
MW433.48 g/mol
LogP4.82
Rot. Bonds3

About 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid

4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid (PubChem CID 114367860) has the molecular formula C14H8Br2ClNO3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid
PubChem CID114367860
Molecular FormulaC14H8Br2ClNO3
Molecular Weight433.48 g/mol
Exact Mass430.86
IUPAC Name4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(Cl)c(NC(=O)c2cc(Br)ccc2Br)c1
InChIInChI=1S/C14H8Br2ClNO3/c15-8-2-3-10(16)9(6-8)13(19)18-12-5-7(14(20)21)1-4-11(12)17/h1-6H,(H,18,19)(H,20,21)
InChIKeyURWJTRBMGFPQMB-UHFFFAOYSA-N
XLogP4.82
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500433.48
LogP ≤ 54.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid?
The IUPAC name of 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid (CID 114367860) is 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid.
What is the SMILES notation for 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid?
The canonical SMILES for 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid is O=C(O)c1ccc(Cl)c(NC(=O)c2cc(Br)ccc2Br)c1.
What is the InChIKey of 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid?
The InChIKey is URWJTRBMGFPQMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Br2ClNO3/c15-8-2-3-10(16)9(6-8)13(19)18-12-5-7(14(20)21)1-4-11(12)17/h1-6H,(H,18,19)(H,20,21).
What are the key properties of 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid?
4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid has a molecular weight of 433.48 g/mol, XLogP of 4.82, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[(2,5-dibromobenzoyl)amino]benzoic acid is sourced from PubChem (CID 114367860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).