C13H6Br3Cl2NO — CID 107791014
2,5-dibromo-N-(4-bromo-2,3-dichlorophenyl)benzamide (PubChem CID 107791014) has the molecular formula C13H6Br3Cl2NO and a molecular weight of 502.82 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-bromo-2,3-dichlorophenyl)benzamide.
| Compound Name | 2,5-dibromo-N-(4-bromo-2,3-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 107791014 |
| Molecular Formula | C13H6Br3Cl2NO |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 498.74 |
| IUPAC Name | 2,5-dibromo-N-(4-bromo-2,3-dichlorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1Cl)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H6Br3Cl2NO/c14-6-1-2-8(15)7(5-6)13(20)19-10-4-3-9(16)11(17)12(10)18/h1-5H,(H,19,20) |
| InChIKey | JXXPVIXYKRDEKJ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|