C13H7BrCl3NO2 — CID 107791092
N-(4-bromo-2,3-dichlorophenyl)-2-chloro-5-hydroxybenzamide (PubChem CID 107791092) has the molecular formula C13H7BrCl3NO2 and a molecular weight of 395.47 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-2-chloro-5-hydroxybenzamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-2-chloro-5-hydroxybenzamide |
|---|---|
| PubChem CID | 107791092 |
| Molecular Formula | C13H7BrCl3NO2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 392.87 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-2-chloro-5-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1Cl)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C13H7BrCl3NO2/c14-8-2-4-10(12(17)11(8)16)18-13(20)7-5-6(19)1-3-9(7)15/h1-5,19H,(H,18,20) |
| InChIKey | XKCWQZXIUBNCPW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|