C13H6Br2Cl2FNO — CID 107953841
3-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-fluorobenzamide (PubChem CID 107953841) has the molecular formula C13H6Br2Cl2FNO and a molecular weight of 441.91 g/mol. Its IUPAC name is 3-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-fluorobenzamide.
| Compound Name | 3-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 107953841 |
| Molecular Formula | C13H6Br2Cl2FNO |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 438.82 |
| IUPAC Name | 3-bromo-N-(4-bromo-2,3-dichlorophenyl)-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1Cl)c1cccc(Br)c1F |
| InChI | InChI=1S/C13H6Br2Cl2FNO/c14-7-4-5-9(11(17)10(7)16)19-13(20)6-2-1-3-8(15)12(6)18/h1-5H,(H,19,20) |
| InChIKey | GDTHVFBMNLYQSR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|