C15H13BrFNO — CID 106543986
3-bromo-N-(2,4-dimethylphenyl)-2-fluorobenzamide (PubChem CID 106543986) has the molecular formula C15H13BrFNO and a molecular weight of 322.18 g/mol. Its IUPAC name is 3-bromo-N-(2,4-dimethylphenyl)-2-fluorobenzamide.
| Compound Name | 3-bromo-N-(2,4-dimethylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 106543986 |
| Molecular Formula | C15H13BrFNO |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3-bromo-N-(2,4-dimethylphenyl)-2-fluorobenzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(Br)c2F)c(C)c1 |
| InChI | InChI=1S/C15H13BrFNO/c1-9-6-7-13(10(2)8-9)18-15(19)11-4-3-5-12(16)14(11)17/h3-8H,1-2H3,(H,18,19) |
| InChIKey | KZTDTAOGODHGTQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |