C15H12Br2FNO — CID 106545347
3-bromo-N-(4-bromo-2,6-dimethylphenyl)-2-fluorobenzamide (PubChem CID 106545347) has the molecular formula C15H12Br2FNO and a molecular weight of 401.07 g/mol. Its IUPAC name is 3-bromo-N-(4-bromo-2,6-dimethylphenyl)-2-fluorobenzamide.
| Compound Name | 3-bromo-N-(4-bromo-2,6-dimethylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 106545347 |
| Molecular Formula | C15H12Br2FNO |
| Molecular Weight | 401.07 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 3-bromo-N-(4-bromo-2,6-dimethylphenyl)-2-fluorobenzamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C15H12Br2FNO/c1-8-6-10(16)7-9(2)14(8)19-15(20)11-4-3-5-12(17)13(11)18/h3-7H,1-2H3,(H,19,20) |
| InChIKey | SIOTXWAVDSMSNE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.07 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |