C15H14BrClN2O — CID 115930129
3-amino-N-(4-bromo-2,6-dimethylphenyl)-2-chlorobenzamide (PubChem CID 115930129) has the molecular formula C15H14BrClN2O and a molecular weight of 353.65 g/mol. Its IUPAC name is 3-amino-N-(4-bromo-2,6-dimethylphenyl)-2-chlorobenzamide.
| Compound Name | 3-amino-N-(4-bromo-2,6-dimethylphenyl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 115930129 |
| Molecular Formula | C15H14BrClN2O |
| Molecular Weight | 353.65 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 3-amino-N-(4-bromo-2,6-dimethylphenyl)-2-chlorobenzamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)c1cccc(N)c1Cl |
| InChI | InChI=1S/C15H14BrClN2O/c1-8-6-10(16)7-9(2)14(8)19-15(20)11-4-3-5-12(18)13(11)17/h3-7H,18H2,1-2H3,(H,19,20) |
| InChIKey | LSYUCMKYFAIGER-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|