C17H19BrN2O — CID 102704950
5-amino-N-(4-bromo-2,6-dimethylphenyl)-2,4-dimethylbenzamide (PubChem CID 102704950) has the molecular formula C17H19BrN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is 5-amino-N-(4-bromo-2,6-dimethylphenyl)-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-(4-bromo-2,6-dimethylphenyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 102704950 |
| Molecular Formula | C17H19BrN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5-amino-N-(4-bromo-2,6-dimethylphenyl)-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)Nc2c(C)cc(Br)cc2C)cc1N |
| InChI | InChI=1S/C17H19BrN2O/c1-9-5-10(2)15(19)8-14(9)17(21)20-16-11(3)6-13(18)7-12(16)4/h5-8H,19H2,1-4H3,(H,20,21) |
| InChIKey | VPVQAQRDIBCNPQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|