C13H9Br2FN2O — CID 106547581
3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-fluorobenzamide (PubChem CID 106547581) has the molecular formula C13H9Br2FN2O and a molecular weight of 388.03 g/mol. Its IUPAC name is 3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-fluorobenzamide.
| Compound Name | 3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 106547581 |
| Molecular Formula | C13H9Br2FN2O |
| Molecular Weight | 388.03 g/mol |
| Exact Mass | 385.91 |
| IUPAC Name | 3-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-fluorobenzamide |
| SMILES | Cc1cc(Br)cnc1NC(=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C13H9Br2FN2O/c1-7-5-8(14)6-17-12(7)18-13(19)9-3-2-4-10(15)11(9)16/h2-6H,1H3,(H,17,18,19) |
| InChIKey | FSQUXNKWMWFNGM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.03 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |