C13H10Br2N2O2 — CID 113266660
5-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-hydroxybenzamide (PubChem CID 113266660) has the molecular formula C13H10Br2N2O2 and a molecular weight of 386.04 g/mol. Its IUPAC name is 5-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 113266660 |
| Molecular Formula | C13H10Br2N2O2 |
| Molecular Weight | 386.04 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | 5-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-hydroxybenzamide |
| SMILES | Cc1cc(Br)cnc1NC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H10Br2N2O2/c1-7-4-9(15)6-16-12(7)17-13(19)10-5-8(14)2-3-11(10)18/h2-6,18H,1H3,(H,16,17,19) |
| InChIKey | ZGJDPVUBWAFKPR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.04 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |