C11H8BrClN2O2 — CID 81489265
N-(5-bromo-3-methyl-2-pyridinyl)-5-chlorofuran-2-carboxamide (PubChem CID 81489265) has the molecular formula C11H8BrClN2O2 and a molecular weight of 315.55 g/mol. Its IUPAC name is N-(5-bromo-3-methyl-2-pyridinyl)-5-chlorofuran-2-carboxamide.
| Compound Name | N-(5-bromo-3-methyl-2-pyridinyl)-5-chlorofuran-2-carboxamide |
|---|---|
| PubChem CID | 81489265 |
| Molecular Formula | C11H8BrClN2O2 |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | N-(5-bromo-3-methyl-2-pyridinyl)-5-chlorofuran-2-carboxamide |
| SMILES | Cc1cc(Br)cnc1NC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H8BrClN2O2/c1-6-4-7(12)5-14-10(6)15-11(16)8-2-3-9(13)17-8/h2-5H,1H3,(H,14,15,16) |
| InChIKey | ACZLVLHXANXHLD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |