C9H7ClN2O3 — CID 29494934
5-chloro-N-(5-methyl-1,2-oxazol-3-yl)furan-2-carboxamide (PubChem CID 29494934) has the molecular formula C9H7ClN2O3 and a molecular weight of 226.62 g/mol. Its IUPAC name is 5-chloro-N-(5-methyl-1,2-oxazol-3-yl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(5-methyl-1,2-oxazol-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 29494934 |
| Molecular Formula | C9H7ClN2O3 |
| Molecular Weight | 226.62 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 5-chloro-N-(5-methyl-1,2-oxazol-3-yl)furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(Cl)o2)no1 |
| InChI | InChI=1S/C9H7ClN2O3/c1-5-4-8(12-15-5)11-9(13)6-2-3-7(10)14-6/h2-4H,1H3,(H,11,12,13) |
| InChIKey | LEPJZJQYHIFXLV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |