C11H9ClN2O3 — CID 106501199
2-chloro-5-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 106501199) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is 2-chloro-5-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
| Compound Name | 2-chloro-5-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 106501199 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-chloro-5-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cc(O)ccc2Cl)no1 |
| InChI | InChI=1S/C11H9ClN2O3/c1-6-4-10(14-17-6)13-11(16)8-5-7(15)2-3-9(8)12/h2-5,15H,1H3,(H,13,14,16) |
| InChIKey | FAZBGEQNUUORHW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |