C12H11FN2O2 — CID 62509692
2-fluoro-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 62509692) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
| Compound Name | 2-fluoro-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 62509692 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-fluoro-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C12H11FN2O2/c1-7-3-4-10(13)9(5-7)12(16)14-11-6-8(2)17-15-11/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | ZNGPZQKMPNXNGG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |