C12H8Cl2FN3O — CID 114073080
N-(2,6-dichloropyrimidin-4-yl)-2-fluoro-5-methylbenzamide (PubChem CID 114073080) has the molecular formula C12H8Cl2FN3O and a molecular weight of 300.12 g/mol. Its IUPAC name is N-(2,6-dichloropyrimidin-4-yl)-2-fluoro-5-methylbenzamide.
| Compound Name | N-(2,6-dichloropyrimidin-4-yl)-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 114073080 |
| Molecular Formula | C12H8Cl2FN3O |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | N-(2,6-dichloropyrimidin-4-yl)-2-fluoro-5-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)Nc2cc(Cl)nc(Cl)n2)c1 |
| InChI | InChI=1S/C12H8Cl2FN3O/c1-6-2-3-8(15)7(4-6)11(19)17-10-5-9(13)16-12(14)18-10/h2-5H,1H3,(H,16,17,18,19) |
| InChIKey | AWWXNTQMPIVODF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |