C11H9BrFN3O2 — CID 62831072
5-amino-2-bromo-4-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 62831072) has the molecular formula C11H9BrFN3O2 and a molecular weight of 314.11 g/mol. Its IUPAC name is 5-amino-2-bromo-4-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
| Compound Name | 5-amino-2-bromo-4-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 62831072 |
| Molecular Formula | C11H9BrFN3O2 |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 5-amino-2-bromo-4-fluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cc(N)c(F)cc2Br)no1 |
| InChI | InChI=1S/C11H9BrFN3O2/c1-5-2-10(16-18-5)15-11(17)6-3-9(14)8(13)4-7(6)12/h2-4H,14H2,1H3,(H,15,16,17) |
| InChIKey | IYSXYEQGBWMQGA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|