C14H10Br3FN2O — CID 62815412
5-amino-2-bromo-N-(2,6-dibromo-4-methylphenyl)-4-fluorobenzamide (PubChem CID 62815412) has the molecular formula C14H10Br3FN2O and a molecular weight of 480.96 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(2,6-dibromo-4-methylphenyl)-4-fluorobenzamide.
| Compound Name | 5-amino-2-bromo-N-(2,6-dibromo-4-methylphenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 62815412 |
| Molecular Formula | C14H10Br3FN2O |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 477.83 |
| IUPAC Name | 5-amino-2-bromo-N-(2,6-dibromo-4-methylphenyl)-4-fluorobenzamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cc(N)c(F)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C14H10Br3FN2O/c1-6-2-9(16)13(10(17)3-6)20-14(21)7-4-12(19)11(18)5-8(7)15/h2-5H,19H2,1H3,(H,20,21) |
| InChIKey | ATCNHZXUDXHSFW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|