C13H7Br2Cl2FN2O — CID 62815588
5-amino-2-bromo-N-(4-bromo-2,6-dichlorophenyl)-4-fluorobenzamide (PubChem CID 62815588) has the molecular formula C13H7Br2Cl2FN2O and a molecular weight of 456.92 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(4-bromo-2,6-dichlorophenyl)-4-fluorobenzamide.
| Compound Name | 5-amino-2-bromo-N-(4-bromo-2,6-dichlorophenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 62815588 |
| Molecular Formula | C13H7Br2Cl2FN2O |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 453.83 |
| IUPAC Name | 5-amino-2-bromo-N-(4-bromo-2,6-dichlorophenyl)-4-fluorobenzamide |
| SMILES | Nc1cc(C(=O)Nc2c(Cl)cc(Br)cc2Cl)c(Br)cc1F |
| InChI | InChI=1S/C13H7Br2Cl2FN2O/c14-5-1-8(16)12(9(17)2-5)20-13(21)6-3-11(19)10(18)4-7(6)15/h1-4H,19H2,(H,20,21) |
| InChIKey | ZWBSYBHMSFIDFM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|