C13H7BrCl2F2N2O — CID 107120471
3-amino-N-(4-bromo-2,6-dichlorophenyl)-2,5-difluorobenzamide (PubChem CID 107120471) has the molecular formula C13H7BrCl2F2N2O and a molecular weight of 396.02 g/mol. Its IUPAC name is 3-amino-N-(4-bromo-2,6-dichlorophenyl)-2,5-difluorobenzamide.
| Compound Name | 3-amino-N-(4-bromo-2,6-dichlorophenyl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 107120471 |
| Molecular Formula | C13H7BrCl2F2N2O |
| Molecular Weight | 396.02 g/mol |
| Exact Mass | 393.91 |
| IUPAC Name | 3-amino-N-(4-bromo-2,6-dichlorophenyl)-2,5-difluorobenzamide |
| SMILES | Nc1cc(F)cc(C(=O)Nc2c(Cl)cc(Br)cc2Cl)c1F |
| InChI | InChI=1S/C13H7BrCl2F2N2O/c14-5-1-8(15)12(9(16)2-5)20-13(21)7-3-6(17)4-10(19)11(7)18/h1-4H,19H2,(H,20,21) |
| InChIKey | AIUNDTWZVZVBLU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.02 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|