C9H10BrFN2O — CID 62831065
5-amino-2-bromo-N-ethyl-4-fluorobenzamide (PubChem CID 62831065) has the molecular formula C9H10BrFN2O and a molecular weight of 261.09 g/mol. Its IUPAC name is 5-amino-2-bromo-N-ethyl-4-fluorobenzamide.
| Compound Name | 5-amino-2-bromo-N-ethyl-4-fluorobenzamide |
|---|---|
| PubChem CID | 62831065 |
| Molecular Formula | C9H10BrFN2O |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 5-amino-2-bromo-N-ethyl-4-fluorobenzamide |
| SMILES | CCNC(=O)c1cc(N)c(F)cc1Br |
| InChI | InChI=1S/C9H10BrFN2O/c1-2-13-9(14)5-3-8(12)7(11)4-6(5)10/h3-4H,2,12H2,1H3,(H,13,14) |
| InChIKey | VWTXWCRRCBNJGJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|