C10H10BrFN2O — CID 62815079
5-amino-2-bromo-4-fluoro-N-prop-2-enylbenzamide (PubChem CID 62815079) has the molecular formula C10H10BrFN2O and a molecular weight of 273.11 g/mol. Its IUPAC name is 5-amino-2-bromo-4-fluoro-N-prop-2-enylbenzamide.
| Compound Name | 5-amino-2-bromo-4-fluoro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 62815079 |
| Molecular Formula | C10H10BrFN2O |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 5-amino-2-bromo-4-fluoro-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cc(N)c(F)cc1Br |
| InChI | InChI=1S/C10H10BrFN2O/c1-2-3-14-10(15)6-4-9(13)8(12)5-7(6)11/h2,4-5H,1,3,13H2,(H,14,15) |
| InChIKey | BYEAPAFHLJHPQJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|