C12H13BrF4N2O — CID 115514877
5-amino-2-bromo-4-fluoro-N-(5,5,5-trifluoropentyl)benzamide (PubChem CID 115514877) has the molecular formula C12H13BrF4N2O and a molecular weight of 357.15 g/mol. Its IUPAC name is 5-amino-2-bromo-4-fluoro-N-(5,5,5-trifluoropentyl)benzamide.
| Compound Name | 5-amino-2-bromo-4-fluoro-N-(5,5,5-trifluoropentyl)benzamide |
|---|---|
| PubChem CID | 115514877 |
| Molecular Formula | C12H13BrF4N2O |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 5-amino-2-bromo-4-fluoro-N-(5,5,5-trifluoropentyl)benzamide |
| SMILES | Nc1cc(C(=O)NCCCCC(F)(F)F)c(Br)cc1F |
| InChI | InChI=1S/C12H13BrF4N2O/c13-8-6-9(14)10(18)5-7(8)11(20)19-4-2-1-3-12(15,16)17/h5-6H,1-4,18H2,(H,19,20) |
| InChIKey | QZSTWBPPLBXWAV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|