C10H10Br2F3NOS — CID 103839434
2,5-dibromo-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide (PubChem CID 103839434) has the molecular formula C10H10Br2F3NOS and a molecular weight of 409.07 g/mol. Its IUPAC name is 2,5-dibromo-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103839434 |
| Molecular Formula | C10H10Br2F3NOS |
| Molecular Weight | 409.07 g/mol |
| Exact Mass | 406.88 |
| IUPAC Name | 2,5-dibromo-N-(5,5,5-trifluoropentyl)thiophene-3-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H10Br2F3NOS/c11-7-5-6(8(12)18-7)9(17)16-4-2-1-3-10(13,14)15/h5H,1-4H2,(H,16,17) |
| InChIKey | WMGDOXHCXKFPHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.07 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|