C9H11Br2NO2S — CID 107168288
2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-carboxamide (PubChem CID 107168288) has the molecular formula C9H11Br2NO2S and a molecular weight of 357.07 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107168288 |
| Molecular Formula | C9H11Br2NO2S |
| Molecular Weight | 357.07 g/mol |
| Exact Mass | 354.89 |
| IUPAC Name | 2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-carboxamide |
| SMILES | O=C(NCCCCO)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H11Br2NO2S/c10-7-5-6(8(11)15-7)9(14)12-3-1-2-4-13/h5,13H,1-4H2,(H,12,14) |
| InChIKey | QGOJYHKMIZCWHX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.07 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|