C11H11Br2NOS — CID 103757999
2,5-dibromo-N-hex-5-ynylthiophene-3-carboxamide (PubChem CID 103757999) has the molecular formula C11H11Br2NOS and a molecular weight of 365.09 g/mol. Its IUPAC name is 2,5-dibromo-N-hex-5-ynylthiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-hex-5-ynylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 103757999 |
| Molecular Formula | C11H11Br2NOS |
| Molecular Weight | 365.09 g/mol |
| Exact Mass | 362.89 |
| IUPAC Name | 2,5-dibromo-N-hex-5-ynylthiophene-3-carboxamide |
| SMILES | C#CCCCCNC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H11Br2NOS/c1-2-3-4-5-6-14-11(15)8-7-9(12)16-10(8)13/h1,7H,3-6H2,(H,14,15) |
| InChIKey | QLZPBEGMVREQIJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.09 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|