C10H13Br2NO2S2 — CID 113264618
2,5-dibromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-3-carboxamide (PubChem CID 113264618) has the molecular formula C10H13Br2NO2S2 and a molecular weight of 403.16 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 113264618 |
| Molecular Formula | C10H13Br2NO2S2 |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 2,5-dibromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCSCCCO)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H13Br2NO2S2/c11-8-6-7(9(12)17-8)10(15)13-2-5-16-4-1-3-14/h6,14H,1-5H2,(H,13,15) |
| InChIKey | KAACJZJFHDBYPA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|