C12H15F2NO2S — CID 103767454
3,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide (PubChem CID 103767454) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide.
| Compound Name | 3,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 103767454 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCCCO)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NO2S/c13-10-6-9(7-11(14)8-10)12(17)15-2-5-18-4-1-3-16/h6-8,16H,1-5H2,(H,15,17) |
| InChIKey | QCQJQCWFIUYLHX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|