C12H14F2N2O4S — CID 106305789
2,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-nitrobenzamide (PubChem CID 106305789) has the molecular formula C12H14F2N2O4S and a molecular weight of 320.32 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-nitrobenzamide.
| Compound Name | 2,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 106305789 |
| Molecular Formula | C12H14F2N2O4S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2,5-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-nitrobenzamide |
| SMILES | O=C(NCCSCCCO)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H14F2N2O4S/c13-9-7-11(16(19)20)10(14)6-8(9)12(18)15-2-5-21-4-1-3-17/h6-7,17H,1-5H2,(H,15,18) |
| InChIKey | XXCSHQLTAYETFU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|