C12H9F2N3O3S — CID 104699379
2,5-difluoro-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 104699379) has the molecular formula C12H9F2N3O3S and a molecular weight of 313.29 g/mol. Its IUPAC name is 2,5-difluoro-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 2,5-difluoro-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 104699379 |
| Molecular Formula | C12H9F2N3O3S |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2,5-difluoro-4-nitro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nccs1)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H9F2N3O3S/c13-8-6-10(17(19)20)9(14)5-7(8)12(18)16-2-1-11-15-3-4-21-11/h3-6H,1-2H2,(H,16,18) |
| InChIKey | VGCHRRBLJGWXGB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|