C12H11FN2OS2 — CID 107029530
2-fluoro-5-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 107029530) has the molecular formula C12H11FN2OS2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-fluoro-5-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 2-fluoro-5-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107029530 |
| Molecular Formula | C12H11FN2OS2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-fluoro-5-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nccs1)c1cc(S)ccc1F |
| InChI | InChI=1S/C12H11FN2OS2/c13-10-2-1-8(17)7-9(10)12(16)15-4-3-11-14-5-6-18-11/h1-2,5-7,17H,3-4H2,(H,15,16) |
| InChIKey | NWTGCOWAEVWUNZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|