C10H12FN3O2S — CID 107034092
N-[2-(carbamoylamino)ethyl]-2-fluoro-5-sulfanylbenzamide (PubChem CID 107034092) has the molecular formula C10H12FN3O2S and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107034092 |
| Molecular Formula | C10H12FN3O2S |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2-fluoro-5-sulfanylbenzamide |
| SMILES | NC(=O)NCCNC(=O)c1cc(S)ccc1F |
| InChI | InChI=1S/C10H12FN3O2S/c11-8-2-1-6(17)5-7(8)9(15)13-3-4-14-10(12)16/h1-2,5,17H,3-4H2,(H,13,15)(H3,12,14,16) |
| InChIKey | MECFSSMNTNIPHN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|