2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid

C11H11F2N3O4 — CID 83116283

IUPAC2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid
SMILESNC(=O)NCCNC(=O)c1cc(F)c(F)cc1C(=O)O
InChIInChI=1S/C11H11F2N3O4/c12-7-3-5(6(10(18)19)4-8(7)13)9(17)15-1-2-16-11(14)20/h3-4H,1-2H2,(H,15,17)(H,18,19)(H3,14,16,20)
InChIKeyRFGMRRZOIIKQGS-UHFFFAOYSA-N
MW287.22 g/mol
LogP0.06
Rot. Bonds5

About 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid

2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid (PubChem CID 83116283) has the molecular formula C11H11F2N3O4 and a molecular weight of 287.22 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid.

Molecular Properties

Compound Name2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid
PubChem CID83116283
Molecular FormulaC11H11F2N3O4
Molecular Weight287.22 g/mol
Exact Mass287.07
IUPAC Name2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid
SMILESNC(=O)NCCNC(=O)c1cc(F)c(F)cc1C(=O)O
InChIInChI=1S/C11H11F2N3O4/c12-7-3-5(6(10(18)19)4-8(7)13)9(17)15-1-2-16-11(14)20/h3-4H,1-2H2,(H,15,17)(H,18,19)(H3,14,16,20)
InChIKeyRFGMRRZOIIKQGS-UHFFFAOYSA-N
XLogP0.06
TPSA121.52 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.22
LogP ≤ 50.06
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid?
The IUPAC name of 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid (CID 83116283) is 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid.
What is the SMILES notation for 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid?
The canonical SMILES for 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid is NC(=O)NCCNC(=O)c1cc(F)c(F)cc1C(=O)O.
What is the InChIKey of 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid?
The InChIKey is RFGMRRZOIIKQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3O4/c12-7-3-5(6(10(18)19)4-8(7)13)9(17)15-1-2-16-11(14)20/h3-4H,1-2H2,(H,15,17)(H,18,19)(H3,14,16,20).
What are the key properties of 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid?
2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid has a molecular weight of 287.22 g/mol, XLogP of 0.06, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid is sourced from PubChem (CID 83116283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).