C11H11F2N3O4 — CID 83116283
2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid (PubChem CID 83116283) has the molecular formula C11H11F2N3O4 and a molecular weight of 287.22 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid.
| Compound Name | 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 83116283 |
| Molecular Formula | C11H11F2N3O4 |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-[2-(carbamoylamino)ethylcarbamoyl]-4,5-difluorobenzoic acid |
| SMILES | NC(=O)NCCNC(=O)c1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C11H11F2N3O4/c12-7-3-5(6(10(18)19)4-8(7)13)9(17)15-1-2-16-11(14)20/h3-4H,1-2H2,(H,15,17)(H,18,19)(H3,14,16,20) |
| InChIKey | RFGMRRZOIIKQGS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|