C10H12FN5O4 — CID 83114921
5-amino-N-[2-(carbamoylamino)ethyl]-4-fluoro-2-nitrobenzamide (PubChem CID 83114921) has the molecular formula C10H12FN5O4 and a molecular weight of 285.24 g/mol. Its IUPAC name is 5-amino-N-[2-(carbamoylamino)ethyl]-4-fluoro-2-nitrobenzamide.
| Compound Name | 5-amino-N-[2-(carbamoylamino)ethyl]-4-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 83114921 |
| Molecular Formula | C10H12FN5O4 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-amino-N-[2-(carbamoylamino)ethyl]-4-fluoro-2-nitrobenzamide |
| SMILES | NC(=O)NCCNC(=O)c1cc(N)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12FN5O4/c11-6-4-8(16(19)20)5(3-7(6)12)9(17)14-1-2-15-10(13)18/h3-4H,1-2,12H2,(H,14,17)(H3,13,15,18) |
| InChIKey | IGMDKEMOJROHPQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|