C12H14FN3O3S — CID 107298197
5-amino-4-fluoro-2-nitro-N-(thiolan-3-ylmethyl)benzamide (PubChem CID 107298197) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is 5-amino-4-fluoro-2-nitro-N-(thiolan-3-ylmethyl)benzamide.
| Compound Name | 5-amino-4-fluoro-2-nitro-N-(thiolan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107298197 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 5-amino-4-fluoro-2-nitro-N-(thiolan-3-ylmethyl)benzamide |
| SMILES | Nc1cc(C(=O)NCC2CCSC2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H14FN3O3S/c13-9-4-11(16(18)19)8(3-10(9)14)12(17)15-5-7-1-2-20-6-7/h3-4,7H,1-2,5-6,14H2,(H,15,17) |
| InChIKey | AOQMRWCQODFRPS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|