C11H12F2N2O2S — CID 112751988
4,5-difluoro-2-nitro-N-(thiolan-3-ylmethyl)aniline (PubChem CID 112751988) has the molecular formula C11H12F2N2O2S and a molecular weight of 274.29 g/mol. Its IUPAC name is 4,5-difluoro-2-nitro-N-(thiolan-3-ylmethyl)aniline.
| Compound Name | 4,5-difluoro-2-nitro-N-(thiolan-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 112751988 |
| Molecular Formula | C11H12F2N2O2S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4,5-difluoro-2-nitro-N-(thiolan-3-ylmethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(F)c(F)cc1NCC1CCSC1 |
| InChI | InChI=1S/C11H12F2N2O2S/c12-8-3-10(11(15(16)17)4-9(8)13)14-5-7-1-2-18-6-7/h3-4,7,14H,1-2,5-6H2 |
| InChIKey | ZBSBRPHQTAJHNX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|