C14H19N3O3S — CID 107296627
N,N-dimethyl-3-nitro-4-(thiolan-3-ylmethylamino)benzamide (PubChem CID 107296627) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N,N-dimethyl-3-nitro-4-(thiolan-3-ylmethylamino)benzamide.
| Compound Name | N,N-dimethyl-3-nitro-4-(thiolan-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 107296627 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N,N-dimethyl-3-nitro-4-(thiolan-3-ylmethylamino)benzamide |
| SMILES | CN(C)C(=O)c1ccc(NCC2CCSC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19N3O3S/c1-16(2)14(18)11-3-4-12(13(7-11)17(19)20)15-8-10-5-6-21-9-10/h3-4,7,10,15H,5-6,8-9H2,1-2H3 |
| InChIKey | AQQBALUGNCDHBY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|