C11H13N3O5 — CID 82989393
2-[4-(dimethylcarbamoyl)-2-nitroanilino]acetic acid (PubChem CID 82989393) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-[4-(dimethylcarbamoyl)-2-nitroanilino]acetic acid.
| Compound Name | 2-[4-(dimethylcarbamoyl)-2-nitroanilino]acetic acid |
|---|---|
| PubChem CID | 82989393 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[4-(dimethylcarbamoyl)-2-nitroanilino]acetic acid |
| SMILES | CN(C)C(=O)c1ccc(NCC(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O5/c1-13(2)11(17)7-3-4-8(12-6-10(15)16)9(5-7)14(18)19/h3-5,12H,6H2,1-2H3,(H,15,16) |
| InChIKey | CWSDJMZFAAKPDV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|