C11H14N4O4 — CID 82989700
4-[(2-amino-2-oxoethyl)amino]-N,N-dimethyl-3-nitrobenzamide (PubChem CID 82989700) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethyl)amino]-N,N-dimethyl-3-nitrobenzamide.
| Compound Name | 4-[(2-amino-2-oxoethyl)amino]-N,N-dimethyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 82989700 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 4-[(2-amino-2-oxoethyl)amino]-N,N-dimethyl-3-nitrobenzamide |
| SMILES | CN(C)C(=O)c1ccc(NCC(N)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N4O4/c1-14(2)11(17)7-3-4-8(13-6-10(12)16)9(5-7)15(18)19/h3-5,13H,6H2,1-2H3,(H2,12,16) |
| InChIKey | QANYRVGURSCQCW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|