C10H10F2N4O4 — CID 103740689
N-[2-(carbamoylamino)ethyl]-2,6-difluoro-3-nitrobenzamide (PubChem CID 103740689) has the molecular formula C10H10F2N4O4 and a molecular weight of 288.21 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 103740689 |
| Molecular Formula | C10H10F2N4O4 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2,6-difluoro-3-nitrobenzamide |
| SMILES | NC(=O)NCCNC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C10H10F2N4O4/c11-5-1-2-6(16(19)20)8(12)7(5)9(17)14-3-4-15-10(13)18/h1-2H,3-4H2,(H,14,17)(H3,13,15,18) |
| InChIKey | IVCVLUAOMUGCOX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|