C9H7BrF2N2O3 — CID 79772843
N-(2-bromoethyl)-2,6-difluoro-3-nitrobenzamide (PubChem CID 79772843) has the molecular formula C9H7BrF2N2O3 and a molecular weight of 309.07 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-(2-bromoethyl)-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 79772843 |
| Molecular Formula | C9H7BrF2N2O3 |
| Molecular Weight | 309.07 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | N-(2-bromoethyl)-2,6-difluoro-3-nitrobenzamide |
| SMILES | O=C(NCCBr)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H7BrF2N2O3/c10-3-4-13-9(15)7-5(11)1-2-6(8(7)12)14(16)17/h1-2H,3-4H2,(H,13,15) |
| InChIKey | DGRMSWNBTCIQIO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.07 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|