C12H13BrF2N2O4 — CID 106307788
N-[3-(2-bromoethoxy)propyl]-2,6-difluoro-3-nitrobenzamide (PubChem CID 106307788) has the molecular formula C12H13BrF2N2O4 and a molecular weight of 367.15 g/mol. Its IUPAC name is N-[3-(2-bromoethoxy)propyl]-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-[3-(2-bromoethoxy)propyl]-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 106307788 |
| Molecular Formula | C12H13BrF2N2O4 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-[3-(2-bromoethoxy)propyl]-2,6-difluoro-3-nitrobenzamide |
| SMILES | O=C(NCCCOCCBr)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H13BrF2N2O4/c13-4-7-21-6-1-5-16-12(18)10-8(14)2-3-9(11(10)15)17(19)20/h2-3H,1,4-7H2,(H,16,18) |
| InChIKey | UISQEPIPSCUDBL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|