C12H14BrF2NO2 — CID 106307478
N-[3-(2-bromoethoxy)propyl]-2,5-difluorobenzamide (PubChem CID 106307478) has the molecular formula C12H14BrF2NO2 and a molecular weight of 322.15 g/mol. Its IUPAC name is N-[3-(2-bromoethoxy)propyl]-2,5-difluorobenzamide.
| Compound Name | N-[3-(2-bromoethoxy)propyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 106307478 |
| Molecular Formula | C12H14BrF2NO2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-[3-(2-bromoethoxy)propyl]-2,5-difluorobenzamide |
| SMILES | O=C(NCCCOCCBr)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H14BrF2NO2/c13-4-7-18-6-1-5-16-12(17)10-8-9(14)2-3-11(10)15/h2-3,8H,1,4-7H2,(H,16,17) |
| InChIKey | SNVLQPCLRUCLHL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|