C13H15F2NO2 — CID 115699987
2,5-difluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide (PubChem CID 115699987) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide.
| Compound Name | 2,5-difluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 115699987 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2,5-difluoro-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide |
| SMILES | C=C(C)COCCNC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2NO2/c1-9(2)8-18-6-5-16-13(17)11-7-10(14)3-4-12(11)15/h3-4,7H,1,5-6,8H2,2H3,(H,16,17) |
| InChIKey | VRIFLVULFPGWFG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|