C18H27F2NO — CID 91717430
2,5-difluoro-N-undecylbenzamide (PubChem CID 91717430) has the molecular formula C18H27F2NO and a molecular weight of 311.42 g/mol. Its IUPAC name is 2,5-difluoro-N-undecylbenzamide.
| Compound Name | 2,5-difluoro-N-undecylbenzamide |
|---|---|
| PubChem CID | 91717430 |
| Molecular Formula | C18H27F2NO |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 2,5-difluoro-N-undecylbenzamide |
| SMILES | CCCCCCCCCCCNC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H27F2NO/c1-2-3-4-5-6-7-8-9-10-13-21-18(22)16-14-15(19)11-12-17(16)20/h11-12,14H,2-10,13H2,1H3,(H,21,22) |
| InChIKey | WQANEXWCWSDWQS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|