C11H12F2INO — CID 106846072
2,5-difluoro-N-(4-iodobutyl)benzamide (PubChem CID 106846072) has the molecular formula C11H12F2INO and a molecular weight of 339.12 g/mol. Its IUPAC name is 2,5-difluoro-N-(4-iodobutyl)benzamide.
| Compound Name | 2,5-difluoro-N-(4-iodobutyl)benzamide |
|---|---|
| PubChem CID | 106846072 |
| Molecular Formula | C11H12F2INO |
| Molecular Weight | 339.12 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 2,5-difluoro-N-(4-iodobutyl)benzamide |
| SMILES | O=C(NCCCCI)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H12F2INO/c12-8-3-4-10(13)9(7-8)11(16)15-6-2-1-5-14/h3-4,7H,1-2,5-6H2,(H,15,16) |
| InChIKey | UTYHQABGAROBJL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|